CAS 848050-87-3 is the registry number for 4-Cyano-N-(3,4-dimethoxyphenyl)benzamide, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 2,5g, 5g, 10g, 25g, 50g.
4-cyano-N-(3,4-dimethoxyphenyl)benzamide (CAS 848050-87-3) is a chemical compound with the molecular formula C16H14N2O3 and a molecular weight of 282.29 g/mol. IUPAC name: 4-cyano-N-(3,4-dimethoxyphenyl)benzamide. InChIKey: OSUUXMGHPCMDQZ-UHFFFAOYSA-N.
| Molecular formula | C16H14N2O3 |
|---|---|
| Molecular weight | 282.29 g/mol |
| IUPAC name | 4-cyano-N-(3,4-dimethoxyphenyl)benzamide |
| InChIKey | OSUUXMGHPCMDQZ-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)NC(=O)C2=CC=C(C=C2)C#N)OC |
Computed by PubChem (NCBI)