Products 848498-04-4
CAS 848498-04-4 is the registry number for Methyl (S)-2-((tert-butoxycarbonyl)amino)-2-(4-oxocyclohexyl)acetate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(4-oxocyclohexyl)acetate (CAS 848498-04-4) is a chemical compound with the molecular formula C14H23NO5 and a molecular weight of 285.34 g/mol. IUPAC name: methyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(4-oxocyclohexyl)acetate. InChIKey: GGNLSAXWVSAWIV-NSHDSACASA-N.
| Molecular formula | C14H23NO5 |
|---|---|
| Molecular weight | 285.34 g/mol |
| IUPAC name | methyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(4-oxocyclohexyl)acetate |
| InChIKey | GGNLSAXWVSAWIV-NSHDSACASA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](C1CCC(=O)CC1)C(=O)OC |
Computed by PubChem (NCBI)