CAS 849035-74-1 appears in our catalog under these names: 1-Fluoro-5-methyl-4-(methylsulfonyl)-2-nitrobenzene, 95+%, 1-Fluoro-5-methyl-4-(methylsulfonyl)-2-nitrobenzene, 95%. Offered by: AmBeed, Fluorochem. Available pack sizes: 25g, 1g, 5g.
1-fluoro-5-methyl-4-methylsulfonyl-2-nitrobenzene (CAS 849035-74-1) is a chemical compound with the molecular formula C8H8FNO4S and a molecular weight of 233.22 g/mol. IUPAC name: 1-fluoro-5-methyl-4-methylsulfonyl-2-nitrobenzene. InChIKey: KHAYNDCHBKGURZ-UHFFFAOYSA-N.
| Molecular formula | C8H8FNO4S |
|---|---|
| Molecular weight | 233.22 g/mol |
| IUPAC name | 1-fluoro-5-methyl-4-methylsulfonyl-2-nitrobenzene |
| InChIKey | KHAYNDCHBKGURZ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1S(=O)(=O)C)[N+](=O)[O-])F |
Computed by PubChem (NCBI)