Products 849052-21-7
CAS 849052-21-7 is the registry number for 3-Isobutoxyphenylboronic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 100g, 25g, 5g.
[3-(2-methylpropoxy)phenyl]boronic acid (CAS 849052-21-7) is a chemical compound with the molecular formula C10H15BO3 and a molecular weight of 194.04 g/mol. IUPAC name: [3-(2-methylpropoxy)phenyl]boronic acid. InChIKey: TZOSYEUNKIDTBY-UHFFFAOYSA-N.
| Molecular formula | C10H15BO3 |
|---|---|
| Molecular weight | 194.04 g/mol |
| IUPAC name | [3-(2-methylpropoxy)phenyl]boronic acid |
| InChIKey | TZOSYEUNKIDTBY-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC=C1)OCC(C)C)(O)O |
Computed by PubChem (NCBI)