CAS 84942-40-5 appears in our catalog under these names: 5'–Chloro–2'–hydroxy–3'–nitroacetophenone, 5'-CHLORO-2'-HYDROXY-3'-NITROACETOPHENO&, 5'-Chloro-2'-hydroxy-3'-nitroacetophenone, 96%, 5'-Chloro-2'-hydroxy-3'-nitroacetophenone, >98.0%(GC)(T), 1-(5-Chloro-2-hydroxy-3-nitrophenyl)ethanone 95%. Offered by: GLPBio, Sigma-Aldrich, Fluorochem, TCI, Ambeed. Available pack sizes: 100g, 25g, 5g, 500g.
1-(5-chloro-2-hydroxy-3-nitrophenyl)ethanone (CAS 84942-40-5) is a chemical compound with the molecular formula C8H6ClNO4 and a molecular weight of 215.59 g/mol. IUPAC name: 1-(5-chloro-2-hydroxy-3-nitrophenyl)ethanone. InChIKey: IUNBIQBAYUBIFD-UHFFFAOYSA-N.
| Molecular formula | C8H6ClNO4 |
|---|---|
| Molecular weight | 215.59 g/mol |
| IUPAC name | 1-(5-chloro-2-hydroxy-3-nitrophenyl)ethanone |
| InChIKey | IUNBIQBAYUBIFD-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=C(C(=CC(=C1)Cl)[N+](=O)[O-])O |
Computed by PubChem (NCBI)