CAS 85-55-2 appears in our catalog under these names: 2-(p-Toluoyl)benzoic acid, 2-(4-Methylbenzoyl)benzoic acid, 98%, 2-(p-Toluoyl)benzoic Acid, 98%, 2-(p-Toluoyl)benzoic Acid, >98.0%(T), 2-(p-Toluoyl)benzoic Acid, 98%, 98%. Offered by: Biosynth, Combi-blocks, AmBeed, TCI, Chemat. Available pack sizes: 1kg, 0,5kg, 2kg, 10kg, 5kg, 25g, 5g, 100g.
2-(4-methylbenzoyl)benzoic acid (CAS 85-55-2) is a chemical compound with the molecular formula C15H12O3 and a molecular weight of 240.25 g/mol. IUPAC name: 2-(4-methylbenzoyl)benzoic acid. InChIKey: ICQOWIXIHDDXDI-UHFFFAOYSA-N.
| Molecular formula | C15H12O3 |
|---|---|
| Molecular weight | 240.25 g/mol |
| IUPAC name | 2-(4-methylbenzoyl)benzoic acid |
| InChIKey | ICQOWIXIHDDXDI-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C(=O)C2=CC=CC=C2C(=O)O |
Computed by PubChem (NCBI)