Products 850567-26-9
CAS 850567-26-9 appears in our catalog under these names: 3–(Methoxycarbamoyl)phenylboronic acid, (3-(Methoxycarbamoyl)phenyl)boronic acid, 97%, (3-(Methoxycarbamoyl)phenyl)boronic acid, 98%. Offered by: GLPBio, Fluorochem, Ambeed, Chemat, BLDpharm. Available pack sizes: 1g, 5g, 250mg, 10g, 100mg.
[3-(methoxycarbamoyl)phenyl]boronic acid (CAS 850567-26-9) is a chemical compound with the molecular formula C8H10BNO4 and a molecular weight of 194.98 g/mol. IUPAC name: [3-(methoxycarbamoyl)phenyl]boronic acid. InChIKey: NDJZQOMZZXSXEM-UHFFFAOYSA-N.
| Molecular formula | C8H10BNO4 |
|---|---|
| Molecular weight | 194.98 g/mol |
| IUPAC name | [3-(methoxycarbamoyl)phenyl]boronic acid |
| InChIKey | NDJZQOMZZXSXEM-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC=C1)C(=O)NOC)(O)O |
Computed by PubChem (NCBI)