Products 850568-59-1
CAS 850568-59-1 appears in our catalog under these names: 4–Ethoxy–3,5–dimethylphenylboronic acid(contains varying amounts of Anhydride), 4-Ethoxy-3,5-dimethylphenylboronic Acid (contains varying amounts of Anhydride), (4-Ethoxy-3,5-dimethylphenyl)boronic acid, 97%, (4-Ethoxy-3,5-dimethylphenyl)boronic acid, 98%, 3,5-Dimethyl-4-ethoxyphenylboronic acid, 97%. Offered by: GLPBio, TCI, Fluorochem, Ambeed, Chemat. Available pack sizes: 100g, 1g, 25g, 5g, 100mg, 250mg.
(4-ethoxy-3,5-dimethylphenyl)boronic acid (CAS 850568-59-1) is a chemical compound with the molecular formula C10H15BO3 and a molecular weight of 194.04 g/mol. IUPAC name: (4-ethoxy-3,5-dimethylphenyl)boronic acid. InChIKey: FMJASQDMWVBTOJ-UHFFFAOYSA-N.
| Molecular formula | C10H15BO3 |
|---|---|
| Molecular weight | 194.04 g/mol |
| IUPAC name | (4-ethoxy-3,5-dimethylphenyl)boronic acid |
| InChIKey | FMJASQDMWVBTOJ-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C(=C1)C)OCC)C)(O)O |
Computed by PubChem (NCBI)
Synonyms:
(4-ethoxy-3,5-dimethylphenyl)boronic acid, 3,5-Dimethyl-4-ethoxybenzeneboronic acid, 3,5-Dimethyl-4-ethoxyphenylboronic acid, 4-Ethoxy-3,5-dimethylphenylboronic acid, (4-Ethoxy-3,5-dimethylphenyl)boronicacid, 4-Ethoxy-3,5-dimethylbenzeneboronic Acid, 4-Ethoxy-3,5-dimethylphenylboronic acid(contains varying amounts of Anhydride), 4-Ethoxy-3,5-dimethylphenylboronic Acid (contains varying amounts of Anhydride)