Products 851016-12-1
CAS 851016-12-1 is the registry number for (S)-2-Amino-1-(4-hydroxypiperidin-1-yl)propan-1-one hydrochloride, 96%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.
(2S)-2-amino-1-(4-hydroxypiperidin-1-yl)propan-1-one;hydrochloride (CAS 851016-12-1) is a chemical compound with the molecular formula C8H17ClN2O2 and a molecular weight of 208.68 g/mol. IUPAC name: (2S)-2-amino-1-(4-hydroxypiperidin-1-yl)propan-1-one;hydrochloride. InChIKey: LEYCKNOEJUXTAL-RGMNGODLSA-N.
| Molecular formula | C8H17ClN2O2 |
|---|---|
| Molecular weight | 208.68 g/mol |
| IUPAC name | (2S)-2-amino-1-(4-hydroxypiperidin-1-yl)propan-1-one;hydrochloride |
| InChIKey | LEYCKNOEJUXTAL-RGMNGODLSA-N |
| SMILES | C[C@@H](C(=O)N1CCC(CC1)O)N.Cl |
Computed by PubChem (NCBI)