CAS 851116-13-7 appears in our catalog under these names: 2-(3-(4-Methylphenyl)-5-sulfanyl-4H-1,2,4-triazol-4-yl)acetic acid, 95%, 2-(3-(4-Methylphenyl)-5-sulfanyl-4H-1,2,4-triazol-4-yl)acetic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 250mg, 2,5g.
2-[3-(4-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]acetic acid (CAS 851116-13-7) is a chemical compound with the molecular formula C11H11N3O2S and a molecular weight of 249.29 g/mol. IUPAC name: 2-[3-(4-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]acetic acid. InChIKey: MVJCJQYGDLMMDC-UHFFFAOYSA-N.
| Molecular formula | C11H11N3O2S |
|---|---|
| Molecular weight | 249.29 g/mol |
| IUPAC name | 2-[3-(4-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]acetic acid |
| InChIKey | MVJCJQYGDLMMDC-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2=NNC(=S)N2CC(=O)O |
Computed by PubChem (NCBI)