CAS 851597-79-0 appears in our catalog under these names: (R)–1–(p–Tolyl)butan–1–amine hydrochloride, (R)-1-(p-Tolyl)butan-1-amine hydrochloride, ≥95%, ≥95%, (R)-1-(p-Tolyl)butan-1-amine hydrochloride, ≥95%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 100mg, 5g, 10g.
(1R)-1-(4-methylphenyl)butan-1-amine;hydrochloride (CAS 851597-79-0) is a chemical compound with the molecular formula C11H18ClN and a molecular weight of 199.72 g/mol. IUPAC name: (1R)-1-(4-methylphenyl)butan-1-amine;hydrochloride. InChIKey: KBCFOUIIWWXJEI-RFVHGSKJSA-N.
| Molecular formula | C11H18ClN |
|---|---|
| Molecular weight | 199.72 g/mol |
| IUPAC name | (1R)-1-(4-methylphenyl)butan-1-amine;hydrochloride |
| InChIKey | KBCFOUIIWWXJEI-RFVHGSKJSA-N |
| SMILES | CCC[C@H](C1=CC=C(C=C1)C)N.Cl |
Computed by PubChem (NCBI)