Products 85163-57-1
CAS 85163-57-1 appears in our catalog under these names: Indole-3-pyruvic Acid-d5, Indole–3–pyruvic acid–d5, Indole-3-pyruvic acid-d5, 96.02%. Offered by: TRC, GLPBio, MedChemExpress. Available pack sizes: 1mg, 2,5mg, 5mg, 500μg, 1 mg.
2-oxo-3-(2,4,5,6,7-pentadeuterio-1H-indol-3-yl)propanoic acid (CAS 85163-57-1) is a chemical compound with the molecular formula C11H9NO3 and a molecular weight of 208.22 g/mol. IUPAC name: 2-oxo-3-(2,4,5,6,7-pentadeuterio-1H-indol-3-yl)propanoic acid. InChIKey: RSTKLPZEZYGQPY-SNOLXCFTSA-N.
| Molecular formula | C11H9NO3 |
|---|---|
| Molecular weight | 208.22 g/mol |
| IUPAC name | 2-oxo-3-(2,4,5,6,7-pentadeuterio-1H-indol-3-yl)propanoic acid |
| InChIKey | RSTKLPZEZYGQPY-SNOLXCFTSA-N |
| SMILES | [2H]C1=C(C(=C2C(=C1[2H])C(=C(N2)[2H])CC(=O)C(=O)O)[2H])[2H] |
Computed by PubChem (NCBI)