CAS 851651-94-0 is the registry number for 1,1,1-Trifluoro-2-(4-nitrophenyl)propan-2-ol. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
1,1,1-trifluoro-2-(4-nitrophenyl)propan-2-ol (CAS 851651-94-0) is a chemical compound with the molecular formula C9H8F3NO3 and a molecular weight of 235.16 g/mol. IUPAC name: 1,1,1-trifluoro-2-(4-nitrophenyl)propan-2-ol. InChIKey: VUESJESTGDDESM-UHFFFAOYSA-N.
| Molecular formula | C9H8F3NO3 |
|---|---|
| Molecular weight | 235.16 g/mol |
| IUPAC name | 1,1,1-trifluoro-2-(4-nitrophenyl)propan-2-ol |
| InChIKey | VUESJESTGDDESM-UHFFFAOYSA-N |
| SMILES | CC(C1=CC=C(C=C1)[N+](=O)[O-])(C(F)(F)F)O |
Computed by PubChem (NCBI)