Products 851756-48-4
CAS 851756-48-4 is the registry number for 6-Bromo-8-methyl-2-(methylthio)pyrido[2,3-d]pyrimidin-7(8H)-one, 95%. Offered by: Chemat. Available pack sizes: 1g, 5g.
6-bromo-8-methyl-2-methylsulfanylpyrido[2,3-d]pyrimidin-7-one (CAS 851756-48-4) is a chemical compound with the molecular formula C9H8BrN3OS and a molecular weight of 286.15 g/mol. IUPAC name: 6-bromo-8-methyl-2-methylsulfanylpyrido[2,3-d]pyrimidin-7-one. InChIKey: DPIIFTICDSQRBV-UHFFFAOYSA-N.
| Molecular formula | C9H8BrN3OS |
|---|---|
| Molecular weight | 286.15 g/mol |
| IUPAC name | 6-bromo-8-methyl-2-methylsulfanylpyrido[2,3-d]pyrimidin-7-one |
| InChIKey | DPIIFTICDSQRBV-UHFFFAOYSA-N |
| SMILES | CN1C2=NC(=NC=C2C=C(C1=O)Br)SC |
Computed by PubChem (NCBI)