CAS 85201-91-8 appears in our catalog under these names: Z–Hyp(tBu)–OH, Cbz-Hyp(tBu)-OH 97%, Z-Hyp(Tbu)-OH, 97%, 97%, Z-Hyp(Tbu)-OH, 97%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 100g, 25g, 5g, 1g, 10g, 250mg.
(2S,4R)-4-[(2-methylpropan-2-yl)oxy]-1-phenylmethoxycarbonylpyrrolidine-2-carboxylic acid (CAS 85201-91-8) is a chemical compound with the molecular formula C17H23NO5 and a molecular weight of 321.4 g/mol. IUPAC name: (2S,4R)-4-[(2-methylpropan-2-yl)oxy]-1-phenylmethoxycarbonylpyrrolidine-2-carboxylic acid. InChIKey: YCTNIMOEFJORHQ-KGLIPLIRSA-N.
| Molecular formula | C17H23NO5 |
|---|---|
| Molecular weight | 321.4 g/mol |
| IUPAC name | (2S,4R)-4-[(2-methylpropan-2-yl)oxy]-1-phenylmethoxycarbonylpyrrolidine-2-carboxylic acid |
| InChIKey | YCTNIMOEFJORHQ-KGLIPLIRSA-N |
| SMILES | CC(C)(C)O[C@@H]1C[C@H](N(C1)C(=O)OCC2=CC=CC=C2)C(=O)O |
Computed by PubChem (NCBI)