CAS 852180-44-0 appears in our catalog under these names: 3-(Isoxazol-5-yl)benzoic acid, 95%, 95%, 3-(Isoxazol-5-yl)benzoic acid, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 10mg, 25mg, 500mg, 1g.
3-(1,2-oxazol-5-yl)benzoic acid (CAS 852180-44-0) is a chemical compound with the molecular formula C10H7NO3 and a molecular weight of 189.17 g/mol. IUPAC name: 3-(1,2-oxazol-5-yl)benzoic acid. InChIKey: PYSKVEAWYLWSAF-UHFFFAOYSA-N.
| Molecular formula | C10H7NO3 |
|---|---|
| Molecular weight | 189.17 g/mol |
| IUPAC name | 3-(1,2-oxazol-5-yl)benzoic acid |
| InChIKey | PYSKVEAWYLWSAF-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C(=O)O)C2=CC=NO2 |
Computed by PubChem (NCBI)