Products 852364-14-8
CAS 852364-14-8 is the registry number for rel-(1R,3s,5S)-6-Oxabicyclo[3.1.0]hexan-3-ylmethyl Tosylate, >95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g.
[(1S,5R)-6-oxabicyclo[3.1.0]hexan-3-yl]methyl 4-methylbenzenesulfonate (CAS 852364-14-8) is a chemical compound with the molecular formula C13H16O4S and a molecular weight of 268.33 g/mol. IUPAC name: [(1S,5R)-6-oxabicyclo[3.1.0]hexan-3-yl]methyl 4-methylbenzenesulfonate. InChIKey: FKCDDERSDRSUEM-VGPLMAKISA-N.
| Molecular formula | C13H16O4S |
|---|---|
| Molecular weight | 268.33 g/mol |
| IUPAC name | [(1S,5R)-6-oxabicyclo[3.1.0]hexan-3-yl]methyl 4-methylbenzenesulfonate |
| InChIKey | FKCDDERSDRSUEM-VGPLMAKISA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OCC2C[C@@H]3[C@H](C2)O3 |
Computed by PubChem (NCBI)