CAS 85278-24-6 appears in our catalog under these names: 3-Chloro-2-phenylprop-2-en-1-amine hydrochloride, 95%, MDL-72274 HCl, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 100mg, 250mg.
(E)-3-chloro-2-phenylprop-2-en-1-amine;hydrochloride (CAS 85278-24-6) is a chemical compound with the molecular formula C9H11Cl2N and a molecular weight of 204.09 g/mol. IUPAC name: (E)-3-chloro-2-phenylprop-2-en-1-amine;hydrochloride. InChIKey: KSVZCVSJFUUXGT-BORNJIKYSA-N.
| Molecular formula | C9H11Cl2N |
|---|---|
| Molecular weight | 204.09 g/mol |
| IUPAC name | (E)-3-chloro-2-phenylprop-2-en-1-amine;hydrochloride |
| InChIKey | KSVZCVSJFUUXGT-BORNJIKYSA-N |
| SMILES | C1=CC=C(C=C1)/C(=C\Cl)/CN.Cl |
Computed by PubChem (NCBI)