Products 852940-45-5
CAS 852940-45-5 is the registry number for 2-{((4-Chloro-2-pyridinyl)carbonyl)amino}-acetic acid. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
2-[(4-chloropyridine-2-carbonyl)amino]acetic acid (CAS 852940-45-5) is a chemical compound with the molecular formula C8H7ClN2O3 and a molecular weight of 214.60 g/mol. IUPAC name: 2-[(4-chloropyridine-2-carbonyl)amino]acetic acid. InChIKey: BERLGDFOMLYTFN-UHFFFAOYSA-N.
| Molecular formula | C8H7ClN2O3 |
|---|---|
| Molecular weight | 214.60 g/mol |
| IUPAC name | 2-[(4-chloropyridine-2-carbonyl)amino]acetic acid |
| InChIKey | BERLGDFOMLYTFN-UHFFFAOYSA-N |
| SMILES | C1=CN=C(C=C1Cl)C(=O)NCC(=O)O |
Computed by PubChem (NCBI)