CAS 853574-48-8 is the registry number for 4–(2,4–Dioxo–1,3–diaza–spiro(4·4)non–3–yl)–butyric acid. Offered by: GLPBio. Available pack sizes: 1g.
4-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)butanoic acid (CAS 853574-48-8) is a chemical compound with the molecular formula C11H16N2O4 and a molecular weight of 240.26 g/mol. IUPAC name: 4-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)butanoic acid. InChIKey: FWUBSDVRUFJATF-UHFFFAOYSA-N.
| Molecular formula | C11H16N2O4 |
|---|---|
| Molecular weight | 240.26 g/mol |
| IUPAC name | 4-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)butanoic acid |
| InChIKey | FWUBSDVRUFJATF-UHFFFAOYSA-N |
| SMILES | C1CCC2(C1)C(=O)N(C(=O)N2)CCCC(=O)O |
Computed by PubChem (NCBI)