CAS 853924-73-9 is the registry number for 3-(4,7-Dimethyl-2-oxo-2H-chromen-3-yl)propanoic acid, 95%. Offered by: AmBeed. Available pack sizes: 5g.
3-(4,7-dimethyl-2-oxochromen-3-yl)propanoic acid (CAS 853924-73-9) is a chemical compound with the molecular formula C14H14O4 and a molecular weight of 246.26 g/mol. IUPAC name: 3-(4,7-dimethyl-2-oxochromen-3-yl)propanoic acid. InChIKey: LMRNIKGMVCSIOU-UHFFFAOYSA-N.
| Molecular formula | C14H14O4 |
|---|---|
| Molecular weight | 246.26 g/mol |
| IUPAC name | 3-(4,7-dimethyl-2-oxochromen-3-yl)propanoic acid |
| InChIKey | LMRNIKGMVCSIOU-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)C(=C(C(=O)O2)CCC(=O)O)C |
Computed by PubChem (NCBI)