CAS 85432-87-7 appears in our catalog under these names: 2-bromo-3,6-dimethoxybenzaldehyde, 97%, 97%, 2-Bromo-3,6-dimethoxybenzaldehyde, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
2-bromo-3,6-dimethoxybenzaldehyde (CAS 85432-87-7) is a chemical compound with the molecular formula C9H9BrO3 and a molecular weight of 245.07 g/mol. IUPAC name: 2-bromo-3,6-dimethoxybenzaldehyde. InChIKey: DVXQFFXHEVVPIS-UHFFFAOYSA-N.
| Molecular formula | C9H9BrO3 |
|---|---|
| Molecular weight | 245.07 g/mol |
| IUPAC name | 2-bromo-3,6-dimethoxybenzaldehyde |
| InChIKey | DVXQFFXHEVVPIS-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C(C=C1)OC)Br)C=O |
Computed by PubChem (NCBI)