Products 854357-48-5
CAS 854357-48-5 appears in our catalog under these names: (2E)-3-[4-(Cyanomethoxy)phenyl]acrylic acid, 95%, 3-(4-(Cyanomethoxy)phenyl)prop-2-enoic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 100mg, 5g, 10g.
(E)-3-[4-(cyanomethoxy)phenyl]prop-2-enoic acid (CAS 854357-48-5) is a chemical compound with the molecular formula C11H9NO3 and a molecular weight of 203.19 g/mol. IUPAC name: (E)-3-[4-(cyanomethoxy)phenyl]prop-2-enoic acid. InChIKey: QQNDRZWCSPILDT-ZZXKWVIFSA-N.
| Molecular formula | C11H9NO3 |
|---|---|
| Molecular weight | 203.19 g/mol |
| IUPAC name | (E)-3-[4-(cyanomethoxy)phenyl]prop-2-enoic acid |
| InChIKey | QQNDRZWCSPILDT-ZZXKWVIFSA-N |
| SMILES | C1=CC(=CC=C1/C=C/C(=O)O)OCC#N |
Computed by PubChem (NCBI)