CAS 854897-58-8 is the registry number for 5,7-Dimethoxy-4-phenylchroman-2-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5,7-dimethoxy-4-phenyl-3,4-dihydrochromen-2-one (CAS 854897-58-8) is a chemical compound with the molecular formula C17H16O4 and a molecular weight of 284.31 g/mol. IUPAC name: 5,7-dimethoxy-4-phenyl-3,4-dihydrochromen-2-one. InChIKey: XACGIFMSUXODHB-UHFFFAOYSA-N.
| Molecular formula | C17H16O4 |
|---|---|
| Molecular weight | 284.31 g/mol |
| IUPAC name | 5,7-dimethoxy-4-phenyl-3,4-dihydrochromen-2-one |
| InChIKey | XACGIFMSUXODHB-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C(CC(=O)O2)C3=CC=CC=C3)C(=C1)OC |
Computed by PubChem (NCBI)