Products 855230-61-4
CAS 855230-61-4 appears in our catalog under these names: 3-Ethoxy-2-fluorophenylboronic Acid (contains varying amounts of Anhydride), 3-Ethoxy-2-fluorophenylboronic acid 98%, 3-Ethoxy-2-fluorophenylboronic acid, 98%, 98%, 3-Ethoxy-2-fluorophenylboronic acid, 98%. Offered by: TCI, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 10g, 25g, 100g.
(3-ethoxy-2-fluorophenyl)boronic acid (CAS 855230-61-4) is a chemical compound with the molecular formula C8H10BFO3 and a molecular weight of 183.97 g/mol. IUPAC name: (3-ethoxy-2-fluorophenyl)boronic acid. InChIKey: DCUXBPVUKGENEJ-UHFFFAOYSA-N.
| Molecular formula | C8H10BFO3 |
|---|---|
| Molecular weight | 183.97 g/mol |
| IUPAC name | (3-ethoxy-2-fluorophenyl)boronic acid |
| InChIKey | DCUXBPVUKGENEJ-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=CC=C1)OCC)F)(O)O |
Computed by PubChem (NCBI)
Synonyms:
3-Ethoxy-2-fluorophenylboronic acid, 3-Ethoxy-2-fluorophenylboronic Acid (contains varying amounts of Anhydride), (3-ethoxy-2-fluorophenyl)boronic acid, 2-Fluoro-3-ethoxyphenylboronic acid, DCUXBPVUKGENEJ-UHFFFAOYSA-N, 3-Ethoxy-2-fluorobenzeneboronic Acid, 3-ethoxy-2-fluoro-phenylboronic acid, (3-ethoxy-2-fluoro-phenyl)boronic acid