Products 855471-18-0
CAS 855471-18-0 appears in our catalog under these names: 2-Chloro-4-(methylamino)-5-nitrobenzoic acid, 95%, 95%, 2-Chloro-4-(methylamino)-5-nitrobenzoic acid, 98%, 2-Chloro-4-(methylamino)-5-nitrobenzoic acid, 95%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 250mg, 1g, 5g, 10g.
2-chloro-4-(methylamino)-5-nitrobenzoic acid (CAS 855471-18-0) is a chemical compound with the molecular formula C8H7ClN2O4 and a molecular weight of 230.60 g/mol. IUPAC name: 2-chloro-4-(methylamino)-5-nitrobenzoic acid. InChIKey: ZOJFCHBGOCAPDQ-UHFFFAOYSA-N.
| Molecular formula | C8H7ClN2O4 |
|---|---|
| Molecular weight | 230.60 g/mol |
| IUPAC name | 2-chloro-4-(methylamino)-5-nitrobenzoic acid |
| InChIKey | ZOJFCHBGOCAPDQ-UHFFFAOYSA-N |
| SMILES | CNC1=C(C=C(C(=C1)Cl)C(=O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)