CAS 85565-93-1 appears in our catalog under these names: 2-Bromo-3,5-dimethoxybenzaldehyde, 95%, 2-Bromo-3,5-dimethoxybenzaldehyde, 97%, 2-bromo-3,5-dimethoxybenzaldehyde, ≥95%, ≥95%, 2-Bromo-3,5-dimethoxybenzaldehyde, ≥95%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
2-bromo-3,5-dimethoxybenzaldehyde (CAS 85565-93-1) is a chemical compound with the molecular formula C9H9BrO3 and a molecular weight of 245.07 g/mol. IUPAC name: 2-bromo-3,5-dimethoxybenzaldehyde. InChIKey: SOKPGTRDTOKLPD-UHFFFAOYSA-N.
| Molecular formula | C9H9BrO3 |
|---|---|
| Molecular weight | 245.07 g/mol |
| IUPAC name | 2-bromo-3,5-dimethoxybenzaldehyde |
| InChIKey | SOKPGTRDTOKLPD-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C(=C1)OC)Br)C=O |
Computed by PubChem (NCBI)