Products 855927-64-9
CAS 855927-64-9 is the registry number for 2-(2-Bromophenyl)-N-(2-hydroxyethyl)acetamide, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 1g, 25g.
2-(2-bromophenyl)-N-(2-hydroxyethyl)acetamide (CAS 855927-64-9) is a chemical compound with the molecular formula C10H12BrNO2 and a molecular weight of 258.11 g/mol. IUPAC name: 2-(2-bromophenyl)-N-(2-hydroxyethyl)acetamide. InChIKey: HZOSIHSERGVSCS-UHFFFAOYSA-N.
| Molecular formula | C10H12BrNO2 |
|---|---|
| Molecular weight | 258.11 g/mol |
| IUPAC name | 2-(2-bromophenyl)-N-(2-hydroxyethyl)acetamide |
| InChIKey | HZOSIHSERGVSCS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CC(=O)NCCO)Br |
Computed by PubChem (NCBI)