CAS 856010-73-6 is the registry number for 2-Ethynyl-4,5-dimethoxybenzaldehyde, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-ethynyl-4,5-dimethoxybenzaldehyde (CAS 856010-73-6) is a chemical compound with the molecular formula C11H10O3 and a molecular weight of 190.19 g/mol. IUPAC name: 2-ethynyl-4,5-dimethoxybenzaldehyde. InChIKey: HGMOYGTWHCODPA-UHFFFAOYSA-N.
| Molecular formula | C11H10O3 |
|---|---|
| Molecular weight | 190.19 g/mol |
| IUPAC name | 2-ethynyl-4,5-dimethoxybenzaldehyde |
| InChIKey | HGMOYGTWHCODPA-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C(=C1)C=O)C#C)OC |
Computed by PubChem (NCBI)