Products 856196-99-1
CAS 856196-99-1 is the registry number for 3-(3-(Benzyloxy)phenyl)-2-oxopropanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-oxo-3-(3-phenylmethoxyphenyl)propanoic acid (CAS 856196-99-1) is a chemical compound with the molecular formula C16H14O4 and a molecular weight of 270.28 g/mol. IUPAC name: 2-oxo-3-(3-phenylmethoxyphenyl)propanoic acid. InChIKey: ZNPMQSYATGFEFF-UHFFFAOYSA-N.
| Molecular formula | C16H14O4 |
|---|---|
| Molecular weight | 270.28 g/mol |
| IUPAC name | 2-oxo-3-(3-phenylmethoxyphenyl)propanoic acid |
| InChIKey | ZNPMQSYATGFEFF-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC=CC(=C2)CC(=O)C(=O)O |
Computed by PubChem (NCBI)