Products 856344-39-3
CAS 856344-39-3 is the registry number for 5-Methyl-1-(4-methylphenyl)-1H-indole-2,3-dione, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
5-methyl-1-(4-methylphenyl)indole-2,3-dione (CAS 856344-39-3) is a chemical compound with the molecular formula C16H13NO2 and a molecular weight of 251.28 g/mol. IUPAC name: 5-methyl-1-(4-methylphenyl)indole-2,3-dione. InChIKey: NHPYKTVEQDQDMW-UHFFFAOYSA-N.
| Molecular formula | C16H13NO2 |
|---|---|
| Molecular weight | 251.28 g/mol |
| IUPAC name | 5-methyl-1-(4-methylphenyl)indole-2,3-dione |
| InChIKey | NHPYKTVEQDQDMW-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)N2C3=C(C=C(C=C3)C)C(=O)C2=O |
Computed by PubChem (NCBI)