CAS 85642-13-3 appears in our catalog under these names: Boc–Ala–NH2, N-Boc-L-alaninamide, 96% , Boc-Ala-NH2, Boc-Ala-NH2, 95%, 95%, Boc-Ala-NH2, 95%. Offered by: GLPBio, Thermo Scientific (Alfa Aesar), Biosynth, Chemat, Fluorochem. Available pack sizes: 100g, 25g, 1g, 5g, 10g, 50g, 250g, 500g.
Tert-butyl N-[(2S)-1-amino-1-oxopropan-2-yl]carbamate (CAS 85642-13-3) is a chemical compound with the molecular formula C8H16N2O3 and a molecular weight of 188.22 g/mol. IUPAC name: tert-butyl N-[(2S)-1-amino-1-oxopropan-2-yl]carbamate. InChIKey: GZKKSKKIABUUCX-YFKPBYRVSA-N.
| Molecular formula | C8H16N2O3 |
|---|---|
| Molecular weight | 188.22 g/mol |
| IUPAC name | tert-butyl N-[(2S)-1-amino-1-oxopropan-2-yl]carbamate |
| InChIKey | GZKKSKKIABUUCX-YFKPBYRVSA-N |
| SMILES | C[C@@H](C(=O)N)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)