CAS 78981-25-6 appears in our catalog under these names: Boc-D-Ala-NH2 97%, Boc-D-Ala-Nh2, 97%, 97%, Boc-D-Ala-NH2, 95%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g, 500g.
Tert-butyl N-[(2R)-1-amino-1-oxopropan-2-yl]carbamate (CAS 78981-25-6) is a chemical compound with the molecular formula C8H16N2O3 and a molecular weight of 188.22 g/mol. IUPAC name: tert-butyl N-[(2R)-1-amino-1-oxopropan-2-yl]carbamate. InChIKey: GZKKSKKIABUUCX-RXMQYKEDSA-N.
| Molecular formula | C8H16N2O3 |
|---|---|
| Molecular weight | 188.22 g/mol |
| IUPAC name | tert-butyl N-[(2R)-1-amino-1-oxopropan-2-yl]carbamate |
| InChIKey | GZKKSKKIABUUCX-RXMQYKEDSA-N |
| SMILES | C[C@H](C(=O)N)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)