Products 856435-40-0
CAS 856435-40-0 is the registry number for Antiproliferative agent-62. Offered by: MedChemExpress. Available pack sizes: Get quote.
(3E)-3-[(2,4-dimethoxyphenyl)methylidene]-1H-indol-2-one (CAS 856435-40-0) is a chemical compound with the molecular formula C17H15NO3 and a molecular weight of 281.30 g/mol. IUPAC name: (3E)-3-[(2,4-dimethoxyphenyl)methylidene]-1H-indol-2-one. InChIKey: PSRHWNITWXEJJW-NTEUORMPSA-N.
| Molecular formula | C17H15NO3 |
|---|---|
| Molecular weight | 281.30 g/mol |
| IUPAC name | (3E)-3-[(2,4-dimethoxyphenyl)methylidene]-1H-indol-2-one |
| InChIKey | PSRHWNITWXEJJW-NTEUORMPSA-N |
| SMILES | COC1=CC(=C(C=C1)/C=C/2\C3=CC=CC=C3NC2=O)OC |
Computed by PubChem (NCBI)