Products 856570-90-6
CAS 856570-90-6 appears in our catalog under these names: 2-Amino-3-(3-methoxyphenyl)propanoic acid hydrochloride, 95%, 2-Amino-3-(3-methoxyphenyl)propanoic acid hydrochloride. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 5g, 1g, 2,5g.
2-amino-3-(3-methoxyphenyl)propanoic acid;hydrochloride (CAS 856570-90-6) is a chemical compound with the molecular formula C10H14ClNO3 and a molecular weight of 231.67 g/mol. IUPAC name: 2-amino-3-(3-methoxyphenyl)propanoic acid;hydrochloride. InChIKey: SZUULLJSXXOQMH-UHFFFAOYSA-N.
| Molecular formula | C10H14ClNO3 |
|---|---|
| Molecular weight | 231.67 g/mol |
| IUPAC name | 2-amino-3-(3-methoxyphenyl)propanoic acid;hydrochloride |
| InChIKey | SZUULLJSXXOQMH-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC(=C1)CC(C(=O)O)N.Cl |
Computed by PubChem (NCBI)