Products 856609-26-2
CAS 856609-26-2 appears in our catalog under these names: 1-(2-Chlorophenyl)-2-(dimethylamino)propan-1-one hydrochloride, 2-chloro-N,N-Dimethylcathinone (hydrochloride). Offered by: Biosynth, Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg.
1-(2-chlorophenyl)-2-(dimethylamino)propan-1-one;hydrochloride (CAS 856609-26-2) is a chemical compound with the molecular formula C11H15Cl2NO and a molecular weight of 248.15 g/mol. IUPAC name: 1-(2-chlorophenyl)-2-(dimethylamino)propan-1-one;hydrochloride. InChIKey: PLWUROLSKSKESN-UHFFFAOYSA-N.
| Molecular formula | C11H15Cl2NO |
|---|---|
| Molecular weight | 248.15 g/mol |
| IUPAC name | 1-(2-chlorophenyl)-2-(dimethylamino)propan-1-one;hydrochloride |
| InChIKey | PLWUROLSKSKESN-UHFFFAOYSA-N |
| SMILES | CC(C(=O)C1=CC=CC=C1Cl)N(C)C.Cl |
Computed by PubChem (NCBI)