Products 856765-68-9
CAS 856765-68-9 appears in our catalog under these names: Ethyl trans-Cinnamate-d5 (phenyl-d5), 98 atom % D, min 98% Chemical Purity, Ethyl cinnamate–d5, Ethyl cinnamate-d5, 99.70%. Offered by: CDN, GLPBio, MedChemExpress. Available pack sizes: 0,5g, 0,25g, 10mg, 5mg, 100 mg, 25 mg, 5 mg, 50 mg.
Ethyl (E)-2,3-dideuterio-3-(2,3,4-trideuteriophenyl)prop-2-enoate (CAS 856765-68-9) is a chemical compound with the molecular formula C11H12O2 and a molecular weight of 181.24 g/mol. IUPAC name: ethyl (E)-2,3-dideuterio-3-(2,3,4-trideuteriophenyl)prop-2-enoate. InChIKey: KBEBGUQPQBELIU-YSVLDWRHSA-N.
| Molecular formula | C11H12O2 |
|---|---|
| Molecular weight | 181.24 g/mol |
| IUPAC name | ethyl (E)-2,3-dideuterio-3-(2,3,4-trideuteriophenyl)prop-2-enoate |
| InChIKey | KBEBGUQPQBELIU-YSVLDWRHSA-N |
| SMILES | [2H]C1=C(C(=C(C=C1)/C(=C(\[2H])/C(=O)OCC)/[2H])[2H])[2H] |
Computed by PubChem (NCBI)