CAS 85679-87-4 appears in our catalog under these names: 2-Propen-1-one, 1-(2,6-dimethoxyphenyl)-3-(4-hydroxyphenyl)-/ 99.06% (existing batch purity), 1-(2,6-Dimethoxyphenyl)-3-(4-hydroxyphenyl)prop-2-en-1-one. Offered by: TargetMol, Chemat. Available pack sizes: 1mg, 2mg, 5mg, 10mg, 25mg, 50mg, 100mg.
1-(2,6-dimethoxyphenyl)-3-(4-hydroxyphenyl)prop-2-en-1-one (CAS 85679-87-4) is a chemical compound with the molecular formula C17H16O4 and a molecular weight of 284.31 g/mol. IUPAC name: 1-(2,6-dimethoxyphenyl)-3-(4-hydroxyphenyl)prop-2-en-1-one. InChIKey: ZCZLYSMNVIUXME-UHFFFAOYSA-N.
| Molecular formula | C17H16O4 |
|---|---|
| Molecular weight | 284.31 g/mol |
| IUPAC name | 1-(2,6-dimethoxyphenyl)-3-(4-hydroxyphenyl)prop-2-en-1-one |
| InChIKey | ZCZLYSMNVIUXME-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=CC=C1)OC)C(=O)C=CC2=CC=C(C=C2)O |
Computed by PubChem (NCBI)