Products 857210-36-7

CAS 857210-36-7 is the registry number for 2-Hydroxy-2-(quinolin-4-yl)acetic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

2-hydroxy-2-quinolin-4-ylacetic acid (CAS 857210-36-7) is a chemical compound with the molecular formula C11H9NO3 and a molecular weight of 203.19 g/mol. IUPAC name: 2-hydroxy-2-quinolin-4-ylacetic acid. InChIKey: CLERFJBHXLGIEB-UHFFFAOYSA-N.

Identity
Molecular formulaC11H9NO3
Molecular weight203.19 g/mol
IUPAC name2-hydroxy-2-quinolin-4-ylacetic acid
InChIKeyCLERFJBHXLGIEB-UHFFFAOYSA-N
SMILESC1=CC=C2C(=C1)C(=CC=N2)C(C(=O)O)O

Computed by PubChem (NCBI)