Products 857652-06-3

CAS 857652-06-3 is the registry number for 2-Bromomethyl-3-methoxybenzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.

2-(bromomethyl)-3-methoxybenzoic acid (CAS 857652-06-3) is a chemical compound with the molecular formula C9H9BrO3 and a molecular weight of 245.07 g/mol. IUPAC name: 2-(bromomethyl)-3-methoxybenzoic acid. InChIKey: FJMAWVQPIPVAMC-UHFFFAOYSA-N.

Identity
Molecular formulaC9H9BrO3
Molecular weight245.07 g/mol
IUPAC name2-(bromomethyl)-3-methoxybenzoic acid
InChIKeyFJMAWVQPIPVAMC-UHFFFAOYSA-N
SMILESCOC1=CC=CC(=C1CBr)C(=O)O

Computed by PubChem (NCBI)