Products 85933-49-9
CAS 85933-49-9 appears in our catalog under these names: Des-2-methyl-2-hydroxymethyl Metalaxy, >95% (HPLC), Metalaxyl-hydroxymethyl, Metalaxyl Metabolite CGA 94689, Concentration: 100 µg/ml Solvent: Acetonitrile. Offered by: TRC, Dr. Ehrenstorfer, Biosynth, HPC Standards. Available pack sizes: 100mg, 250mg, 25mg, 10mg, 5mg, 2mg, 50mg, 1x1ml.
Methyl 2-[2-(hydroxymethyl)-N-(2-methoxyacetyl)-6-methylanilino]propanoate (CAS 85933-49-9) is a chemical compound with the molecular formula C15H21NO5 and a molecular weight of 295.33 g/mol. IUPAC name: methyl 2-[2-(hydroxymethyl)-N-(2-methoxyacetyl)-6-methylanilino]propanoate. InChIKey: JRTUFKUEKGCXQP-UHFFFAOYSA-N.
| Molecular formula | C15H21NO5 |
|---|---|
| Molecular weight | 295.33 g/mol |
| IUPAC name | methyl 2-[2-(hydroxymethyl)-N-(2-methoxyacetyl)-6-methylanilino]propanoate |
| InChIKey | JRTUFKUEKGCXQP-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)CO)N(C(C)C(=O)OC)C(=O)COC |
Computed by PubChem (NCBI)