Products 859776-95-7
CAS 859776-95-7 is the registry number for 4-(2-Hydroxyethoxy)-3-nitropyridine, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2-[(3-nitro-4-pyridinyl)oxy]ethanol (CAS 859776-95-7) is a chemical compound with the molecular formula C7H8N2O4 and a molecular weight of 184.15 g/mol. IUPAC name: 2-[(3-nitro-4-pyridinyl)oxy]ethanol. InChIKey: VXSWGQCWDQHEPC-UHFFFAOYSA-N.
| Molecular formula | C7H8N2O4 |
|---|---|
| Molecular weight | 184.15 g/mol |
| IUPAC name | 2-[(3-nitro-4-pyridinyl)oxy]ethanol |
| InChIKey | VXSWGQCWDQHEPC-UHFFFAOYSA-N |
| SMILES | C1=CN=CC(=C1OCCO)[N+](=O)[O-] |
Computed by PubChem (NCBI)