CAS 859851-00-6 appears in our catalog under these names: 3-(2-Furyl)-1-methyl-1h-pyrazole-5-carboxylic acid, 95%, 3-(Furan-2-yl)-1-methyl-1H-pyrazole-5-carboxylic acid, 98%, 3-(2-Furyl)-1-methyl-1H-pyrazole-5-carboxylic acid, 97% . Offered by: Combi-blocks, AmBeed, Thermo Scientific. Available pack sizes: 10g, 250mg, 1g, 5g.
3-(furan-2-yl)-1-methylpyrazole-5-carboxylic acid (CAS 859851-00-6) is a chemical compound with the molecular formula C9H8N2O3 and a molecular weight of 192.17 g/mol. IUPAC name: 3-(furan-2-yl)-1-methylpyrazole-5-carboxylic acid. InChIKey: MOPCEJWYTICWJM-UHFFFAOYSA-N.
| Molecular formula | C9H8N2O3 |
|---|---|
| Molecular weight | 192.17 g/mol |
| IUPAC name | 3-(furan-2-yl)-1-methylpyrazole-5-carboxylic acid |
| InChIKey | MOPCEJWYTICWJM-UHFFFAOYSA-N |
| SMILES | CN1C(=CC(=N1)C2=CC=CO2)C(=O)O |
Computed by PubChem (NCBI)