CAS 859964-08-2 appears in our catalog under these names: 5-Amino-2-hydroxyisophthalic acid, 95+%, 5-Amino-2-hydroxybenzene-1,3-dicarboxylic acid, 5-Amino-2-hydroxyisophthalic acid, 95%, 95%, Mesalamine Impurity 10, Mesalazine Dicarboxylic Acid. Offered by: Chemat Brand, Biosynth, Chemat, TRC, MedChemExpress. Available pack sizes: on request, 0,1g, 0,05g, 0,25g, 0,5g, 100mg, Get quote.
5-amino-2-hydroxybenzene-1,3-dicarboxylic acid (CAS 859964-08-2) is a chemical compound with the molecular formula C8H7NO5 and a molecular weight of 197.14 g/mol. IUPAC name: 5-amino-2-hydroxybenzene-1,3-dicarboxylic acid. InChIKey: LZWQHDDDGHXOEL-UHFFFAOYSA-N.
| Molecular formula | C8H7NO5 |
|---|---|
| Molecular weight | 197.14 g/mol |
| IUPAC name | 5-amino-2-hydroxybenzene-1,3-dicarboxylic acid |
| InChIKey | LZWQHDDDGHXOEL-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1C(=O)O)O)C(=O)O)N |
Computed by PubChem (NCBI)