CAS 860193-81-3 appears in our catalog under these names: 6-Ethylquinolin-5-amine, 95%, 6-Ethylquinolin-5-amine. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
6-ethylquinolin-5-amine (CAS 860193-81-3) is a chemical compound with the molecular formula C11H12N2 and a molecular weight of 172.23 g/mol. IUPAC name: 6-ethylquinolin-5-amine. InChIKey: FBDWMJWOBXUIIN-UHFFFAOYSA-N.
| Molecular formula | C11H12N2 |
|---|---|
| Molecular weight | 172.23 g/mol |
| IUPAC name | 6-ethylquinolin-5-amine |
| InChIKey | FBDWMJWOBXUIIN-UHFFFAOYSA-N |
| SMILES | CCC1=C(C2=C(C=C1)N=CC=C2)N |
Computed by PubChem (NCBI)