Products 860356-56-5
CAS 860356-56-5 is the registry number for Tubulin inhibitor 20. Offered by: MedChemExpress. Available pack sizes: Get quote.
(2E)-2-benzylidene-4,5,6-trimethoxy-3H-inden-1-one (CAS 860356-56-5) is a chemical compound with the molecular formula C19H18O4 and a molecular weight of 310.3 g/mol. IUPAC name: (2E)-2-benzylidene-4,5,6-trimethoxy-3H-inden-1-one. InChIKey: DTXWZXBYITUUST-UKTHLTGXSA-N.
| Molecular formula | C19H18O4 |
|---|---|
| Molecular weight | 310.3 g/mol |
| IUPAC name | (2E)-2-benzylidene-4,5,6-trimethoxy-3H-inden-1-one |
| InChIKey | DTXWZXBYITUUST-UKTHLTGXSA-N |
| SMILES | COC1=C(C(=C2C/C(=C\C3=CC=CC=C3)/C(=O)C2=C1)OC)OC |
Computed by PubChem (NCBI)