CAS 860644-54-8 is the registry number for Glycopyrrolate Impurity 22. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl (2S)-2-cyclopentyl-2-hydroxy-2-phenylacetate (CAS 860644-54-8) is a chemical compound with the molecular formula C14H18O3 and a molecular weight of 234.29 g/mol. IUPAC name: methyl (2S)-2-cyclopentyl-2-hydroxy-2-phenylacetate. InChIKey: FGMUSNHTKNGVQD-CQSZACIVSA-N.
| Molecular formula | C14H18O3 |
|---|---|
| Molecular weight | 234.29 g/mol |
| IUPAC name | methyl (2S)-2-cyclopentyl-2-hydroxy-2-phenylacetate |
| InChIKey | FGMUSNHTKNGVQD-CQSZACIVSA-N |
| SMILES | COC(=O)[C@](C1CCCC1)(C2=CC=CC=C2)O |
Computed by PubChem (NCBI)