CAS 860648-89-1 is the registry number for 3-[(4-Hydroxy-3-methoxy-5-methylphenyl)methylene]-1,3-dihydro-2h-indol-2-one, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
(3Z)-3-[(4-hydroxy-3-methoxy-5-methylphenyl)methylidene]-1H-indol-2-one (CAS 860648-89-1) is a chemical compound with the molecular formula C17H15NO3 and a molecular weight of 281.30 g/mol. IUPAC name: (3Z)-3-[(4-hydroxy-3-methoxy-5-methylphenyl)methylidene]-1H-indol-2-one. InChIKey: GGYAMVBEDYKCLT-JYRVWZFOSA-N.
| Molecular formula | C17H15NO3 |
|---|---|
| Molecular weight | 281.30 g/mol |
| IUPAC name | (3Z)-3-[(4-hydroxy-3-methoxy-5-methylphenyl)methylidene]-1H-indol-2-one |
| InChIKey | GGYAMVBEDYKCLT-JYRVWZFOSA-N |
| SMILES | CC1=CC(=CC(=C1O)OC)/C=C\2/C3=CC=CC=C3NC2=O |
Computed by PubChem (NCBI)