CAS 861242-86-6 is the registry number for L-Proline, 5,5-dimethyl-, hydrochloride (9CI). Offered by: Creative Peptides. Available pack sizes: on request.
(2S)-5,5-dimethylpyrrolidine-2-carboxylic acid;hydrochloride (CAS 861242-86-6) is a chemical compound with the molecular formula C7H14ClNO2 and a molecular weight of 179.64 g/mol. IUPAC name: (2S)-5,5-dimethylpyrrolidine-2-carboxylic acid;hydrochloride. InChIKey: OHZZJQWZBJKQLS-JEDNCBNOSA-N.
| Molecular formula | C7H14ClNO2 |
|---|---|
| Molecular weight | 179.64 g/mol |
| IUPAC name | (2S)-5,5-dimethylpyrrolidine-2-carboxylic acid;hydrochloride |
| InChIKey | OHZZJQWZBJKQLS-JEDNCBNOSA-N |
| SMILES | CC1(CC[C@H](N1)C(=O)O)C.Cl |
Computed by PubChem (NCBI)