Products 1796882-98-8

CAS 1796882-98-8 appears in our catalog under these names: 5,5-Dimethylpyrrolidine-2-carboxylic acid hydrochloride, 98+%, 5,5-Dimethylpyrrolidine-2-carboxylic acid hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 10g, 5g, 50mg, 0,5g.

5,5-dimethylpyrrolidine-2-carboxylic acid;hydrochloride (CAS 1796882-98-8) is a chemical compound with the molecular formula C7H14ClNO2 and a molecular weight of 179.64 g/mol. IUPAC name: 5,5-dimethylpyrrolidine-2-carboxylic acid;hydrochloride. InChIKey: OHZZJQWZBJKQLS-UHFFFAOYSA-N.

Identity
Molecular formulaC7H14ClNO2
Molecular weight179.64 g/mol
IUPAC name5,5-dimethylpyrrolidine-2-carboxylic acid;hydrochloride
InChIKeyOHZZJQWZBJKQLS-UHFFFAOYSA-N
SMILESCC1(CCC(N1)C(=O)O)C.Cl

Computed by PubChem (NCBI)